For research use only. Not for therapeutic Use.
5(6)-Carboxynaphthofluorescein(Cat No.:M107574)is a pH-sensitive fluorescent dye widely used in biochemical assays, live-cell imaging, and molecular biology research. As a ratiometric pH indicator, it exhibits pH-dependent fluorescence shifts, making it valuable for studying intracellular pH changes, enzyme activity, and cellular metabolism. The carboxyl functional group enhances solubility and allows for bioconjugation with proteins, peptides, and biomolecules. This dye is commonly applied in fluorescence microscopy, flow cytometry, and pH-sensitive biosensor development, particularly in cell biology, drug discovery, and biomedical diagnostics for monitoring cellular environments and metabolic processes.
CAS Number | 128724-35-6 |
Synonyms | acetic acid;7′,19′-dihydroxyspiro[2-benzofuran-3,13′-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaene]-1-one |
Molecular Formula | C30H20O7 |
Purity | ≥95% |
InChI | InChI=1S/C28H16O5.C2H4O2/c29-17-7-9-19-15(13-17)5-11-23-25(19)32-26-20-10-8-18(30)14-16(20)6-12-24(26)28(23)22-4-2-1-3-21(22)27(31)33-28;1-2(3)4/h1-14,29-30H;1H3,(H,3,4) |
InChIKey | NDOGQANHKWHOGD-UHFFFAOYSA-N |
SMILES | CC(=O)O.C1=CC=C2C(=C1)C(=O)OC23C4=C(C5=C(C=C4)C=C(C=C5)O)OC6=C3C=CC7=C6C=CC(=C7)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |