For research use only. Not for therapeutic Use.
5,6-Dehydro finasteride (Cat No.:C000770) is a derivative of finasteride, a medication used to treat benign prostatic hyperplasia (BPH) and androgenetic alopecia (male pattern baldness). This compound likely holds significance in medicinal chemistry and drug development. The modification involves the removal of hydrogen atoms, potentially affecting its interactions with 5α-reductase enzymes and its ability to inhibit dihydrotestosterone (DHT) production. Researchers may study its effects on androgen receptors, its pharmacological profile, and potential therapeutic applications.
CAS Number | 1800205-94-0 |
Synonyms | Finasteride EP Impurity C |
Molecular Formula | C₂₃H₃₄N₂O₂ |
Purity | ≥95% |
Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
Appearance | Off-White to Pale Beige Solid |
Storage | 4°C, Hygroscopic |
IUPAC Name | (1S,3aS,3bS,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,9b,10,11-decahydroindeno[5,4-f]quinoline-1-carboxamide |
InChI | InChI=1S/C23H34N2O2/c1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/h9,11,13-17H,6-8,10,12H2,1-5H3,(H,24,26)(H,25,27)/t14-,15-,16-,17+,22-,23+/m0/s1 |
InChIKey | LNFKNSWOVCPIGC-FIIPNDBVSA-N |
SMILES | CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CC=C4C3(C=CC(=O)N4)C |