For research use only. Not for therapeutic Use.
5,6-Difluoro-1H-indazole-3-carboxylic acid is a heterocyclic compound featuring a difluoro-substituted indazole ring with a carboxylic acid group at the 3-position. This compound is significant in medicinal chemistry for its potential biological activities, including anticancer and anti-inflammatory properties. The presence of fluorine atoms enhances its metabolic stability and lipophilicity, improving its pharmacokinetic profile. Its unique structure allows for further modifications, making it a valuable intermediate for developing novel therapeutic agents and exploring various chemical applications.
Catalog Number | M108228 |
CAS Number | 129295-33-6 |
Molecular Formula | C8H4F2N2O2 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | 5,6-difluoro-1H-indazole-3-carboxylic acid |
InChI | InChI=1S/C8H4F2N2O2/c9-4-1-3-6(2-5(4)10)11-12-7(3)8(13)14/h1-2H,(H,11,12)(H,13,14) |
InChIKey | NKVHNRMDLDYXKZ-UHFFFAOYSA-N |
SMILES | C1=C2C(=CC(=C1F)F)NN=C2C(=O)O |