For research use only. Not for therapeutic Use.
5,6-Difluoropyridine-2-carboxylic acid(Cat No.:L048433)is a high-purity fluorinated pyridine derivative widely used in pharmaceutical research and organic synthesis. Featuring two fluorine atoms at the 5 and 6 positions and a carboxylic acid group at the 2-position, this compound is crucial for the development of bioactive molecules, particularly in the synthesis of novel drugs and agrochemicals. Its unique structure allows for targeted chemical modifications, making it a valuable intermediate in medicinal chemistry. 5,6-Difluoropyridine-2-carboxylic acid offers reliable performance and consistency in complex synthetic processes.
CAS Number | 851386-38-4 |
Molecular Formula | C6H3F2NO2 |
Purity | ≥95% |
IUPAC Name | 5,6-difluoropyridine-2-carboxylic acid |
InChI | InChI=1S/C6H3F2NO2/c7-3-1-2-4(6(10)11)9-5(3)8/h1-2H,(H,10,11) |
InChIKey | NWMYBARTEFULTJ-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1F)F)C(=O)O |