For research use only. Not for therapeutic Use.
5,6-Diiodothieno[2,3-d]pyrimidin-4(1H)-one (Cat.No:L003670) is a pivotal chemical compound with notable applications in pharmaceutical research. Its distinctive structure incorporates iodine atoms, imparting unique reactivity and pharmacological properties. This compound serves as a key intermediate in the synthesis of specialized pharmaceutical agents, emphasizing its significance in drug development.
Catalog Number | L003670 |
CAS Number | 1799610-90-4 |
Molecular Formula | C6H2I2N2OS |
Purity | ≥95% |
IUPAC Name | 5,6-diiodo-3H-thieno[2,3-d]pyrimidin-4-one |
InChI | InChI=1S/C6H2I2N2OS/c7-3-2-5(11)9-1-10-6(2)12-4(3)8/h1H,(H,9,10,11) |
InChIKey | ZRMNNJDYWUTFEN-UHFFFAOYSA-N |
SMILES | C1=NC2=C(C(=C(S2)I)I)C(=O)N1 |