For research use only. Not for therapeutic Use.
5,6-Dimethoxybenzimidazole（Cat No.:L017711）is a benzimidazole derivative characterized by methoxy groups at the 5 and 6 positions, enhancing its chemical stability and solubility. This compound serves as a critical intermediate in the synthesis of pharmaceuticals and organic materials. It has applications in creating antifungal agents and potential treatments for neurological disorders due to its ability to interact with biological targets, including enzymes and receptors. Its unique structure enables modifications that lead to new therapeutic molecules, making it a valuable component in drug development processes aimed at innovative health solutions.
| Catalog Number | L017711 |
| CAS Number | 72721-02-9 |
| Molecular Formula | C9H10N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5,6-dimethoxy-1H-benzimidazole |
| InChI | InChI=1S/C9H10N2O2/c1-12-8-3-6-7(11-5-10-6)4-9(8)13-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | BTWUUHKQHOSMIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC=N2)OC |
