For research use only. Not for therapeutic Use.
5,6-Dimethyl-1H-benzo[d]imidazole(Cat No.:I018186) is an endogenous metabolite, meaning it is naturally produced within the body as part of normal physiological processes. It belongs to the class of benzimidazole compounds. While specific functions and roles of 5,6-Dimethyl-1H-benzo[d]imidazole are not explicitly mentioned in the given information, as an endogenous metabolite, it likely plays a role in various biochemical pathways and biological processes within the body.
CAS Number | 582-60-5 |
Molecular Formula | C₉H₁₀N₂ |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 5,6-dimethyl-1H-benzimidazole |
InChI | InChI=1S/C9H10N2/c1-6-3-8-9(4-7(6)2)11-5-10-8/h3-5H,1-2H3,(H,10,11) |
InChIKey | LJUQGASMPRMWIW-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1C)N=CN2 |