For research use only. Not for therapeutic Use.
5,6,7,8-Tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine hydrochloride(CAT: L011838) is a bicyclic heterocyclic compound that contains a fused triazolo-pyrazine ring system, with a tetrahydro modification indicating saturation at the 5, 6, 7, and 8 positions. This compound is presented as a hydrochloride salt, enhancing its solubility in water and making it more suitable for various biological and chemical studies. Due to the triazole and pyrazine moieties, this compound is often of interest in medicinal chemistry as a potential scaffold for drug discovery, particularly in the development of CNS-active agents or enzyme inhibitors. Its bicyclic structure also offers opportunities for further functionalization, making it a versatile intermediate for the synthesis of biologically active molecules.
CAS Number | 837430-14-5 |
Molecular Formula | C5H9ClN4 |
Purity | ≥95% |
IUPAC Name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
InChI | InChI=1S/C5H8N4.ClH/c1-2-9-4-7-8-5(9)3-6-1;/h4,6H,1-3H2;1H |
InChIKey | NKEHUOIDQUKFDV-UHFFFAOYSA-N |