Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5,7-Dichloro-3-isopropylpyrazolo[1,5-a]pyrimidine
For research use only. Not for therapeutic Use.
5,7-Dichloro-3-isopropylpyrazolo[1,5-a]pyrimidine(CAT: L040793) is a fused heterocyclic compound featuring a pyrazolo[1,5-a]pyrimidine core with chlorine atoms at the 5 and 7 positions and an isopropyl group at the 3 position. This compound is commonly used in medicinal chemistry as a scaffold for developing bioactive molecules, particularly for applications in enzyme inhibition and receptor modulation. The dichlorinated positions contribute to its electronic characteristics, potentially enhancing binding affinity with biological targets. 5,7-Dichloro-3-isopropylpyrazolo[1,5-a]pyrimidine is often explored in the development of therapeutic agents targeting diseases in areas such as oncology and immunology, where fused pyrazolo-pyrimidine structures are known to exhibit activity. This compound’s structure enables it to participate in further functionalization, aiding researchers in optimizing pharmacokinetic and pharmacodynamic properties in drug design.
CAS Number | 771510-32-8 |
Molecular Formula | C9H9Cl2N3 |
Purity | ≥95% |
IUPAC Name | 5,7-dichloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidine |
InChI | InChI=1S/C9H9Cl2N3/c1-5(2)6-4-12-14-8(11)3-7(10)13-9(6)14/h3-5H,1-2H3 |
InChIKey | VAAJGCDAYQIYPO-UHFFFAOYSA-N |