For research use only. Not for therapeutic Use.
5,7-Difluoroindole（Cat No.:L041601）is a fluorinated indole derivative used in pharmaceutical and chemical research. The compound features fluorine atoms at the 5 and 7 positions on the indole ring, enhancing its chemical stability and biological activity. This makes it a valuable intermediate for synthesizing a variety of bioactive molecules, particularly in the development of anticancer, antiviral, and CNS-targeting drugs. With its unique structure and reactivity, 5,7-Difluoroindole is an essential building block for medicinal chemists focused on innovative drug discovery and development.
| Catalog Number | L041601 |
| CAS Number | 301856-25-7 |
| Molecular Formula | C8H5F2N |
| Purity | ≥95% |
| IUPAC Name | 5,7-difluoro-1H-indole |
| InChI | InChI=1S/C8H5F2N/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H |
| InChIKey | WZPOGQRJXZGSMH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C=C21)F)F |
