5,7-Difluoroindole(Cat No.:L041601)is a fluorinated indole derivative used in pharmaceutical and chemical research. The compound features fluorine atoms at the 5 and 7 positions on the indole ring, enhancing its chemical stability and biological activity. This makes it a valuable intermediate for synthesizing a variety of bioactive molecules, particularly in the development of anticancer, antiviral, and CNS-targeting drugs. With its unique structure and reactivity, 5,7-Difluoroindole is an essential building block for medicinal chemists focused on innovative drug discovery and development.
Catalog Number | L041601 |
CAS Number | 301856-25-7 |
Molecular Formula | C8H5F2N |
Purity | ≥95% |
IUPAC Name | 5,7-difluoro-1H-indole |
InChI | InChI=1S/C8H5F2N/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H |
InChIKey | WZPOGQRJXZGSMH-UHFFFAOYSA-N |
SMILES | C1=CNC2=C(C=C(C=C21)F)F |