For research use only. Not for therapeutic Use.
5,7-Difluoroquinolin-3-amine(Cat No.:L007696), is a chemical compound featuring a quinoline ring substituted with amino groups at the 3-position and difluorine atoms at the 5 and 7 positions. This specific molecular structure is significant in medicinal chemistry and organic synthesis. Researchers use it as a key intermediate for creating diverse organic molecules, particularly in developing pharmaceuticals and agrochemicals. Its unique structure allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in chemical research and chemical development.
CAS Number | 225366-94-9 |
Molecular Formula | C9H6F2N2 |
Purity | ≥95% |
IUPAC Name | 5,7-difluoroquinolin-3-amine |
InChI | InChI=1S/C9H6F2N2/c10-5-1-8(11)7-3-6(12)4-13-9(7)2-5/h1-4H,12H2 |
InChIKey | ZKGZXHDAOCLPIS-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C2=C1N=CC(=C2)N)F)F |