For research use only. Not for therapeutic Use.
5,7-Difluoroquinolin-3-ol(Cat No.:L007483), is a chemical compound with significance in medicinal and synthetic chemistry. This compound possesses a quinoline-3-ol core with fluorine substitutions at the 5th and 7th positions, imparting unique properties for various applications. Researchers exploit its structure in the development of pharmaceutical agents, particularly in designing novel drugs with potential biological activities. Additionally, its strategic placement of fluorine atoms enhances its reactivity and stability, making it a valuable building block in organic synthesis.
Catalog Number | L007483 |
CAS Number | 1483673-86-4 |
Molecular Formula | C9H5F2NO |
Purity | ≥95% |
IUPAC Name | 5,7-difluoroquinolin-3-ol |
InChI | InChI=1S/C9H5F2NO/c10-5-1-8(11)7-3-6(13)4-12-9(7)2-5/h1-4,13H |
InChIKey | INEJYQSSWQTPCO-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C2=C1N=CC(=C2)O)F)F |