For research use only. Not for therapeutic Use.
5,7-Dihydroxychromone (Cat.No:R019307) is a natural flavonoid compound found in plants. It exhibits antioxidant, anti-inflammatory, and potential anticancer activities. With its unique chemical structure, 5,7-Dihydroxychromone holds promise in various therapeutic applications and is studied for its role in promoting human health and preventing chronic diseases.
| Catalog Number | R019307 |
| CAS Number | 31721-94-5 |
| Synonyms | 5,7-dihydroxychromen-4-one |
| Molecular Formula | C9H6O4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | >7.1mg/mL in DMSO |
| IUPAC Name | 5,7-dihydroxychromen-4-one |
| InChI | InChI=1S/C9H6O4/c10-5-3-7(12)9-6(11)1-2-13-8(9)4-5/h1-4,10,12H |
| InChIKey | NYCXYKOXLNBYID-UHFFFAOYSA-N |
| SMILES | C1=COC2=CC(=CC(=C2C1=O)O)O |
