For research use only. Not for therapeutic Use.
5,7-Dimethoxychroman-4-one(CAT: L037658) is a high-purity chroman derivative widely used in pharmaceutical and biochemical research. Featuring methoxy groups at the 5 and 7 positions of the chroman-4-one framework, this compound exhibits unique chemical properties, making it a valuable intermediate for synthesizing complex organic molecules. Its stable and reactive structure is ideal for applications in drug discovery, natural product synthesis, and the development of bioactive compounds. 5,7-Dimethoxychroman-4-one ensures reliable performance and supports innovative research efforts in medicinal chemistry and advanced material science.
CAS Number | 54107-66-3 |
Molecular Formula | C11H12O4 |
Purity | ≥95% |
IUPAC Name | 5,7-dimethoxy-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C11H12O4/c1-13-7-5-9(14-2)11-8(12)3-4-15-10(11)6-7/h5-6H,3-4H2,1-2H3 |
InChIKey | XZDATLYQNQGRDB-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C(=O)CCO2)C(=C1)OC |