For research use only. Not for therapeutic Use.
5,7-Dimethoxyindan-1-one is an organic compound characterized by an indanone core with two methoxy groups attached at the 5 and 7 positions. It serves as an important intermediate in the synthesis of pharmaceuticals and bioactive molecules. The indanone structure provides a rigid framework, while the methoxy groups enhance its reactivity, making it useful in creating molecules with potential therapeutic properties. This compound has applications in drug discovery, particularly in the development of inhibitors and modulators targeting various biological processes, including neurological and metabolic disorders. Its versatility makes it valuable in medicinal and organic chemistry research.
CAS Number | 880-87-5 |
Synonyms | 2,3-Dihydro-5,7-dimethoxy-1H-inden-1-one; 5,7-Dimethoxy-1-Indanone |
Molecular Formula | C11H12O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5,7-dimethoxy-2,3-dihydroinden-1-one |
InChI | InChI=1S/C11H12O3/c1-13-8-5-7-3-4-9(12)11(7)10(6-8)14-2/h5-6H,3-4H2,1-2H3 |
InChIKey | ZLTCXTRHEQUDGV-UHFFFAOYSA-N |
SMILES | COC1=CC(=C2C(=C1)CCC2=O)OC |