Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid
For research use only. Not for therapeutic Use.
5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid(Cat No.:L042589)is a heterocyclic compound featuring a pyrazolopyrimidine core with methyl groups at the 5 and 7 positions and a carboxylic acid group at the 3 position. This structure is particularly effective in medicinal chemistry for its potential use as a scaffold in drug design, targeting a wide range of biological activities. The carboxylic acid group enhances solubility and bioavailability, making it suitable for modification into various derivatives. This compound is key in developing new therapeutic agents, especially in the areas of oncology and neurology, due to its versatile and reactive framework.
CAS Number | 90349-23-8 |
Molecular Formula | C9H9N3O2 |
Purity | ≥95% |
IUPAC Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
InChI | InChI=1S/C9H9N3O2/c1-5-3-6(2)12-8(11-5)7(4-10-12)9(13)14/h3-4H,1-2H3,(H,13,14) |
InChIKey | UWWGTDIBDPROEH-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC2=C(C=NN12)C(=O)O)C |