For research use only. Not for therapeutic Use.
5,7,3′-Trihydroxy-6,4′,5′-trimethoxyflavone is a naturally occurring flavonoid featuring three hydroxyl groups and three methoxy groups attached to its flavone backbone. This compound is known for its antioxidant, anti-inflammatory, and potential anticancer properties. It is widely studied in pharmaceutical and nutraceutical research for its bioactivity and therapeutic potential. The unique combination of hydroxyl and methoxy groups enhances its solubility and biological activity, making it a valuable candidate for developing treatments targeting oxidative stress and inflammation-related diseases.
| Catalog Number | R072379 |
| CAS Number | 78417-26-2 |
| Molecular Formula | C18H16O8 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | 5,7-dihydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxychromen-4-one |
| InChI | InChI=1S/C18H16O8/c1-23-14-5-8(4-10(20)17(14)24-2)12-6-9(19)15-13(26-12)7-11(21)18(25-3)16(15)22/h4-7,20-22H,1-3H3 |
| InChIKey | PMBOOVZSTMWOFS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC)O |
