For research use only. Not for therapeutic Use.
5,7,4′-Trimethoxyflavone(CAT: I018405) is a flavonoid compound found in various plants. It is also known by other names such as 5,7,4′-Trimethoxyflavonol and 3′,4′,5,7-Tetramethoxyflavone. This compound possesses antioxidant and anti-inflammatory properties and has been studied for its potential health benefits. It exhibits various biological activities, including antimicrobial, anticancer, and neuroprotective effects. 5,7,4′-Trimethoxyflavone is commonly used in natural medicine and herbal products due to its pharmacological properties. Further research is ongoing to explore its therapeutic potential and mechanisms of action.
| CAS Number | 5631-70-9 |
| Molecular Formula | C₁₈H₁₆O₅ |
| Purity | ≥95% |
| Target | Epigenetics |
| IUPAC Name | 5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChI | InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3 |
| InChIKey | ZXJJBDHPUHUUHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
