For research use only. Not for therapeutic Use.
5,8-Dichloroisoquinoline is a versatile chemical compound used in pharmaceutical and chemical research. It features two chlorine atoms positioned at the 5- and 8-positions on an isoquinoline ring structure, contributing to its unique reactivity and properties. This compound is useful in the synthesis of bioactive molecules, particularly in drug discovery and development. Its potential applications include serving as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Researchers utilize 5,8-Dichloroisoquinoline for its distinct functionalization capabilities.
| Catalog Number | L017112 |
| CAS Number | 73075-59-9 |
| Molecular Formula | C9H5Cl2N |
| Purity | ≥95% |
| IUPAC Name | 5,8-dichloroisoquinoline |
| InChI | InChI=1S/C9H5Cl2N/c10-8-1-2-9(11)7-5-12-4-3-6(7)8/h1-5H |
| InChIKey | MIYJUWWLNPMRCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NC=CC2=C1Cl)Cl |
