Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-(2-Methyl-5-nitrophenyl)-2-(methylthio)pyrido[3,4-d]pyrimidin-8(7H)-one
For research use only. Not for therapeutic Use.
6-(2-Methyl-5-nitrophenyl)-2-(methylthio)pyrido[3,4-d]pyrimidin-8(7H)-one(CAT: L000438) is a significant compound with applications in pharmaceutical and organic chemistry. In the pharmaceutical realm, it is a promising candidate for drug development due to its unique chemical structure. This compound can potentially target specific biological pathways or receptors, making it valuable for the development of novel therapeutic agents.
CAS Number | 2470433-84-0 |
Molecular Formula | C15H12N4O3S |
Purity | ≥95% |
IUPAC Name | 6-(2-methyl-5-nitrophenyl)-2-methylsulfanyl-7H-pyrido[3,4-d]pyrimidin-8-one |
InChI | InChI=1S/C15H12N4O3S/c1-8-3-4-10(19(21)22)6-11(8)12-5-9-7-16-15(23-2)18-13(9)14(20)17-12/h3-7H,1-2H3,(H,17,20) |
InChIKey | QYOZHTQBXNJUFH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |