For research use only. Not for therapeutic Use.
6-(2,2,2-Trifluoro-ethoxy)-pyridine-3-carbaldehyde is a fluorinated heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure, which includes a trifluoroethoxy group and a pyridine ring with an aldehyde functional group, makes it a versatile intermediate for creating bioactive molecules and complex heterocycles. This compound is particularly valuable in the development of fluorinated drug candidates and agrochemicals due to the unique reactivity and stability provided by the trifluoromethyl group, contributing to advancements in medicinal chemistry.
CAS Number | 159981-19-8 |
Molecular Formula | C8H6F3NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-(2,2,2-trifluoroethoxy)pyridine-3-carbaldehyde |
InChI | InChI=1S/C8H6F3NO2/c9-8(10,11)5-14-7-2-1-6(4-13)3-12-7/h1-4H,5H2 |
InChIKey | XKOBNYABZGUMQN-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1C=O)OCC(F)(F)F |