For research use only. Not for therapeutic Use.
6-(3-chlorophenyl)pyridazin-3(2H)-one(Cat No.:L007598), is a chemical compound featuring a pyridazinone ring with a chlorine-substituted phenyl group at the 6-position. This specific molecular structure is of interest in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to develop new pharmaceutical agents. Compounds like this serve as valuable intermediates in organic synthesis, enabling the creation of diverse molecules for biological testing. Its aromatic and heterocyclic nature offers opportunities for chemical modifications, making it a valuable scaffold for designing novel compounds with potential pharmacological activities and contributing to advancements in healthcare research.
CAS Number | 62902-66-3 |
Molecular Formula | C10H7ClN2O |
Purity | ≥95% |
IUPAC Name | 3-(3-chlorophenyl)-1H-pyridazin-6-one |
InChI | InChI=1S/C10H7ClN2O/c11-8-3-1-2-7(6-8)9-4-5-10(14)13-12-9/h1-6H,(H,13,14) |
InChIKey | YRWWFLYKKZTALE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)C2=NNC(=O)C=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |