For research use only. Not for therapeutic Use.
6-(3-Fluorophenyl)nicotinaldehyde(Cat No.:L031130)is a heterocyclic aromatic compound featuring a fluorophenyl group attached to a nicotinaldehyde core. This compound is valuable in pharmaceutical and chemical research as an intermediate in the synthesis of bioactive molecules, including potential drug candidates and ligands for receptor studies. The presence of both the fluorine atom and the aldehyde group allows for versatile chemical modifications, making it useful in creating complex molecular frameworks. High purity and consistent quality ensure reliable performance in advanced research and medicinal chemistry applications.
CAS Number | 898795-81-8 |
Molecular Formula | C12H8FNO |
Purity | ≥95% |
IUPAC Name | 6-(3-fluorophenyl)pyridine-3-carbaldehyde |
InChI | InChI=1S/C12H8FNO/c13-11-3-1-2-10(6-11)12-5-4-9(8-15)7-14-12/h1-8H |
InChIKey | NYXTZOPVKQNRIS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)F)C2=NC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |