For research use only. Not for therapeutic Use.
6-(3-Fluorophenyl)nicotinic acid is an aromatic compound composed of a nicotinic acid (pyridine-3-carboxylic acid) core substituted with a 3-fluorophenyl group at the 6-position. The presence of both a fluorinated phenyl ring and a carboxylic acid group provides this molecule with unique reactivity and potential bioactivity, making it valuable in medicinal chemistry. Frequently used as a building block in synthesizing pharmacologically active compounds, it plays a role in developing agents for various therapeutic applications, including anti-inflammatory and anti-cancer research.
CAS Number | 582325-22-2 |
Molecular Formula | C12H8FNO2 |
Purity | ≥95% |
IUPAC Name | 6-(3-fluorophenyl)pyridine-3-carboxylic acid |
InChI | InChI=1S/C12H8FNO2/c13-10-3-1-2-8(6-10)11-5-4-9(7-14-11)12(15)16/h1-7H,(H,15,16) |
InChIKey | OYDONGYKOJEHSZ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)F)C2=NC=C(C=C2)C(=O)O |