For research use only. Not for therapeutic Use.
6-(3,5-Dicarboxyphenyl)nicotinic acid(CAT: L003534) is a multifunctional aromatic compound featuring a nicotinic acid (pyridine-3-carboxylic acid) core linked to a 3,5-dicarboxyphenyl group. This structure, with three carboxylic acid groups, allows for multiple points of interaction, making it valuable in coordination chemistry and materials science. It is commonly used in synthesizing metal-organic frameworks (MOFs) and supramolecular structures due to its ability to form stable complexes with metal ions. Additionally, this compound’s polyfunctional nature lends itself to drug development and biochemical research, where it can serve as a precursor in creating derivatives for studying molecular recognition, catalysis, and potential therapeutic applications. Its aromatic structure and electron-donating carboxyl groups also allow for investigations into charge transfer and binding interactions in various chemical environments.
CAS Number | 1261935-37-8 |
Molecular Formula | C14H9NO6 |
Purity | ≥95% |
IUPAC Name | 5-(5-carboxypyridin-2-yl)benzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C14H9NO6/c16-12(17)7-1-2-11(15-6-7)8-3-9(13(18)19)5-10(4-8)14(20)21/h1-6H,(H,16,17)(H,18,19)(H,20,21) |
InChIKey | BNBRLMQMUPXKHD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |