For research use only. Not for therapeutic Use.
6-Acetylglucose is a glucose derivative where the hydroxyl group at the 6th position is acetylated. This compound is often used in carbohydrate chemistry and synthetic biology as an intermediate for the preparation of more complex molecules, such as glycosides and oligosaccharides. The acetyl group offers protection during chemical reactions, allowing for selective modifications at other positions of the glucose molecule. Researchers use 6-acetylglucose in the synthesis of bioactive compounds and for studying enzymatic processes related to glucose metabolism and glycosylation.
CAS Number | 7286-45-5 |
Synonyms | 6-O-Acetyl-D-glucose; D-Glucose 6-Acetate |
Molecular Formula | C8H14O7 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] acetate |
InChI | InChI=1S/C8H14O7/c1-4(10)15-3-6(12)8(14)7(13)5(11)2-9/h2,5-8,11-14H,3H2,1H3/t5-,6+,7+,8+/m0/s1 |
InChIKey | VFPUCPVAZOMVLI-LXGUWJNJSA-N |
SMILES | CC(=O)OCC(C(C(C(C=O)O)O)O)O |