For research use only. Not for therapeutic Use.
6-Amino-1-methyl-1H-indole-3-carboxylic acid(Cat No.:L007733), is a chemical compound with a core structure consisting of an indole ring substituted with an amino group at position 6 and a carboxylic acid group at position 3. Indole derivatives are essential building blocks in the synthesis of various biologically active compounds, including pharmaceuticals and natural products. This specific compound, featuring both an amino and a carboxylic acid functional group, is valuable in medicinal chemistry as it can be modified to create analogs for drug development, providing researchers with diverse options for designing potential therapeutic agents.
CAS Number | 1058740-80-9 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
IUPAC Name | 6-amino-1-methylindole-3-carboxylic acid |
InChI | InChI=1S/C10H10N2O2/c1-12-5-8(10(13)14)7-3-2-6(11)4-9(7)12/h2-5H,11H2,1H3,(H,13,14) |
InChIKey | UDBHAWXAHRQVEX-UHFFFAOYSA-N |
SMILES | CN1C=C(C2=C1C=C(C=C2)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |