For research use only. Not for therapeutic Use.
6-Amino-2-bromo-3-chlorobenzoic acid(Cat No.L038913)is a halogenated aromatic compound with significant utility in pharmaceutical and chemical research. Featuring both bromine and chlorine atoms along with an amino group, this compound serves as a versatile building block for the synthesis of complex organic molecules. It is particularly valuable in the development of new drug candidates, including inhibitors and bioactive compounds. The presence of multiple functional groups allows for diverse chemical modifications, making it an essential intermediate in advanced organic synthesis and medicinal chemistry research.
CAS Number | 65971-76-8 |
Molecular Formula | C7H5BrClNO2 |
Purity | ≥95% |
IUPAC Name | 6-amino-2-bromo-3-chlorobenzoic acid |
InChI | InChI=1S/C7H5BrClNO2/c8-6-3(9)1-2-4(10)5(6)7(11)12/h1-2H,10H2,(H,11,12) |
InChIKey | PXHYZQUJCFJBRY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1N)C(=O)O)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |