For research use only. Not for therapeutic Use.
6-Amino-2-hydroxymethylhexan-1-ol(Cat No.:R001837) is a chemical compound with the molecular formula C7H17NO2. It is an amino alcohol, specifically a derivative of hexan-1-ol, which has an amino group (-NH2) at the sixth carbon and a hydroxymethyl group (-CH2OH) at the second carbon. This compound may have applications in organic synthesis and pharmaceutical chemistry as a building block or intermediate for the synthesis of more complex molecules. It could also be used in research settings to study amino alcohols and their properties, as well as their potential biological activities.
CAS Number | 125162-81-4 |
Synonyms | 2-(4-Aminobutyl)-1,3-propanediol; |
Molecular Formula | C7H17NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4-aminobutyl)propane-1,3-diol |
InChI | InChI=1S/C7H17NO2/c8-4-2-1-3-7(5-9)6-10/h7,9-10H,1-6,8H2 |
InChIKey | KUZCSLNRDJKKMK-UHFFFAOYSA-N |
SMILES | C(CCN)CC(CO)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |