For research use only. Not for therapeutic Use.
6-Amino-2-methylphenol (Cat.No:M084036) is a chemical compound commonly employed in the synthesis of dyes, particularly hair dyes. Its aromatic amine structure contributes to color development. Additionally, it finds applications in pharmaceuticals and organic synthesis. However, proper handling is crucial due to its potential skin and eye irritant properties.
CAS Number | 17672-22-9 |
Molecular Formula | C7H9NO |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 2-amino-6-methylphenol |
InChI | InChI=1S/C7H9NO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,8H2,1H3 |
InChIKey | ALQKEYVDQYGZDN-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |