For research use only. Not for therapeutic Use.
6-Amino-5-azacytidine(Cat No.:R045299)is a nucleoside analog and cytidine derivative studied for its potential antiviral and anticancer properties. It disrupts nucleic acid metabolism by incorporating into DNA and RNA, interfering with replication and transcription processes, which makes it useful in targeting rapidly dividing cells. Its mechanism, similar to other nucleoside analogs, has shown promise in inhibiting viral replication and inducing cellular differentiation in cancer research. However, due to toxicity concerns, its use is largely restricted to research settings, where it aids in studying epigenetic regulation and nucleic acid synthesis.
CAS Number | 105331-00-8 |
Synonyms | 4,6-Diamino-1-β-D-ribofuranosyl-1,3,5-triazin-2(1H)-one |
Molecular Formula | C8H13N5O5 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | 4,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
InChI | InChI=1S/C8H13N5O5/c9-6-11-7(10)13(8(17)12-6)5-4(16)3(15)2(1-14)18-5/h2-5,14-16H,1H2,(H4,9,10,11,12,17)/t2-,3-,4-,5-/m1/s1 |
InChIKey | HHBIDXKTBPRKSK-TXICZTDVSA-N |
SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C(=NC(=NC2=O)N)N)O)O)O |