For research use only. Not for therapeutic Use.
6-Amino-5-β-D-glucopyranosyloxyuracil(Cat No.:M087122)is a high-purity nucleoside derivative essential in biochemical and pharmaceutical research. Known for its role in nucleic acid metabolism, it serves as a key intermediate in the synthesis of antiviral and anticancer agents. This compound is crucial for studying enzymatic processes involving nucleosides and exploring therapeutic applications in viral infections and cancer treatment. Its precise molecular structure and activity make it invaluable for drug development and molecular biology research, contributing significantly to advancements in medical science and therapeutic innovation.
CAS Number | 19286-37-4 |
Synonyms | Convicine |
Molecular Formula | C10H15N3O8 |
Purity | ≥95% |
Target | Plants |
Storage | Store at -20C |
IUPAC Name | 6-amino-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidine-2,4-dione |
InChI | InChI=1S/C10H15N3O8/c11-7-6(8(18)13-10(19)12-7)21-9-5(17)4(16)3(15)2(1-14)20-9/h2-5,9,14-17H,1H2,(H4,11,12,13,18,19)/t2-,3-,4+,5-,9+/m1/s1 |
InChIKey | JJWYIMQKLTVAGZ-SYCVNHKBSA-N |
SMILES | C(C1C(C(C(C(O1)OC2=C(NC(=O)NC2=O)N)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |