For research use only. Not for therapeutic Use.
(6-Amino-5-bromopyridin-3-yl)boronic acid (Cat.No:L003717) is a crucial chemical compound widely employed in pharmaceutical research. Its distinct structure, featuring a boronic acid and amino-bromopyridine moiety, makes it a versatile reagent in Suzuki-Miyaura cross-coupling reactions. This compound is instrumental in the synthesis of complex organic molecules, particularly in drug discovery efforts.
Catalog Number | L003717 |
CAS Number | 2408430-22-6 |
Molecular Formula | C5H6BBrN2O2 |
Purity | ≥95% |
IUPAC Name | (6-amino-5-bromopyridin-3-yl)boronic acid |
InChI | InChI=1S/C5H6BBrN2O2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2,10-11H,(H2,8,9) |
InChIKey | XKIVIKLHZICDAV-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(N=C1)N)Br)(O)O |