For research use only. Not for therapeutic Use.
6-Amino-5-bromoquinoxaline(CAT: R009042) is a chemical compound of interest in organic synthesis and pharmaceutical research. This compound features a quinoxaline ring with an amino group and a bromine substituent, making it valuable in the design and synthesis of organic molecules, including pharmaceutical intermediates and bioactive compounds. Its unique structure offers the potential for diverse chemical reactions, making it a versatile building block in organic chemistry.
| Catalog Number | R009042 |
| CAS Number | 50358-63-9 |
| Synonyms | 5-Bromo-6-quinoxalinamine; 5-Bromo-6-aminoquinoxaline; |
| Molecular Formula | C8H6BrN3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-bromoquinoxalin-6-amine |
| InChI | InChI=1S/C8H6BrN3/c9-7-5(10)1-2-6-8(7)12-4-3-11-6/h1-4H,10H2 |
| InChIKey | IRAOSCSPAYZRJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C(=C1N)Br |
