For research use only. Not for therapeutic Use.
6-Amino-5-chloro-2-methylnicotinonitrile(Cat No.:L018928)is a key intermediate in the synthesis of pharmaceutical compounds and agrochemicals. The nicotinonitrile core, with an amino group at the 6-position, a chlorine atom at the 5-position, and a methyl group at the 2-position, offers unique reactivity for creating complex heterocyclic structures. This compound is particularly valuable in the development of biologically active molecules, including potential drug candidates. Its versatile functional groups make it an essential building block for researchers focused on advanced organic synthesis, medicinal chemistry, and the development of novel therapeutic agents.
CAS Number | 1504581-92-3 |
Molecular Formula | C7H6ClN3 |
Purity | ≥95% |
IUPAC Name | 6-amino-5-chloro-2-methylpyridine-3-carbonitrile |
InChI | InChI=1S/C7H6ClN3/c1-4-5(3-9)2-6(8)7(10)11-4/h2H,1H3,(H2,10,11) |
InChIKey | OHZUCWMBBRJFNP-UHFFFAOYSA-N |
SMILES | CC1=NC(=C(C=C1C#N)Cl)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |