For research use only. Not for therapeutic Use.
6-amino-5-fluorobenzo[c][1,2]oxaborol-1(3H)-ol (Cat.No:L003985) is a pivotal chemical compound with diverse applications. Its unique structure, combining an amino group, fluorobenzene, and boron-containing moiety, imparts distinctive reactivity. This compound serves as a valuable scaffold in the development of specialized materials and pharmaceuticals.
Catalog Number | L003985 |
CAS Number | 943311-50-0 |
Molecular Formula | C7H7BFNO2 |
Purity | ≥95% |
IUPAC Name | 5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
InChI | InChI=1S/C7H7BFNO2/c9-6-1-4-3-12-8(11)5(4)2-7(6)10/h1-2,11H,3,10H2 |
InChIKey | OTNUPHBMWRIGJT-UHFFFAOYSA-N |
SMILES | B1(C2=CC(=C(C=C2CO1)F)N)O |