For research use only. Not for therapeutic Use.
(6-Amino-5-methylpyridin-3-yl)boronic acid(Cat No.:L003130)is a high-purity boronic acid derivative crucial for pharmaceutical research and organic synthesis. With an amino group at the 6-position and a methyl group at the 5-position on a pyridine ring, this compound is particularly valuable in the development of novel therapeutic agents. It serves as a key intermediate in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds in complex organic molecules. Ideal for medicinal chemistry and drug discovery, this compound ensures precision and efficiency in research applications.
CAS Number | 1032759-01-5 |
Molecular Formula | C6H9BN2O2 |
Purity | ≥95% |
IUPAC Name | (6-amino-5-methylpyridin-3-yl)boronic acid |
InChI | InChI=1S/C6H9BN2O2/c1-4-2-5(7(10)11)3-9-6(4)8/h2-3,10-11H,1H3,(H2,8,9) |
InChIKey | LVIPAYBVNBMLBM-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(N=C1)N)C)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |