For research use only. Not for therapeutic Use.
6-Aminocaproic acid-d6(Cat No.:S000663) is a deuterated form of 6-aminocaproic acid, where all six hydrogen atoms in the amino group and the adjacent methylene group are replaced with deuterium. This modification enhances its molecular stability, making it highly suitable as an internal standard for analytical techniques such as mass spectrometry and NMR spectroscopy. 6-Aminocaproic acid is a synthetic derivative of the amino acid lysine, used clinically to prevent excessive bleeding by inhibiting plasminogen activators. The deuteration in 6-Aminocaproic acid-d6 allows for precise pharmacokinetic and metabolic studies, providing deeper insights into its therapeutic effects and mechanism of action.
CAS Number | 1228656-08-3 |
Molecular Formula | C6H7D6NO2 |
Purity | ≥95% |
IUPAC Name | 6-amino-3,3,4,4,5,5-hexadeuteriohexanoic acid |
InChI | InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)/i1D2,2D2,3D2 |
InChIKey | SLXKOJJOQWFEFD-NMFSSPJFSA-N |
SMILES | C(CCC(=O)O)CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |