For research use only. Not for therapeutic Use.
6-(Aminomethyl)isoquinolin-1-amine dihydrochloride(CAT: L024684) is a high-purity heterocyclic compound featuring an isoquinoline core with an aminomethyl group at the 6-position and an amine functional group at the 1-position. Presented as a dihydrochloride salt, it is highly soluble and stable, making it suitable for various biochemical and pharmaceutical research applications. This compound serves as a valuable intermediate in the synthesis of bioactive molecules, including enzyme inhibitors, receptor modulators, and other therapeutic agents. 6-(Aminomethyl)isoquinolin-1-amine dihydrochloride is an essential building block for innovative research in medicinal chemistry, fine chemical production, and drug discovery efforts.
CAS Number | 639860-72-3 |
Molecular Formula | C10H13Cl2N3 |
Purity | ≥95% |
IUPAC Name | 6-(aminomethyl)isoquinolin-1-amine;dihydrochloride |
InChI | InChI=1S/C10H11N3.2ClH/c11-6-7-1-2-9-8(5-7)3-4-13-10(9)12;;/h1-5H,6,11H2,(H2,12,13);2*1H |
InChIKey | LAXWAYHNIVBBPC-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN=C2N)C=C1CN.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |