For research use only. Not for therapeutic Use.
6-Aminonicotinamide（Cat No.:I011570）is an analog of niacinamide, widely used in biochemical research as an inhibitor of the pentose phosphate pathway (PPP). By targeting glucose-6-phosphate dehydrogenase, it disrupts NADPH production and cellular redox balance, inducing oxidative stress in cells. This mechanism makes 6-Aminonicotinamide valuable in cancer studies, as cancer cells rely heavily on PPP for growth and survival. It also serves as a tool to investigate cellular responses to oxidative stress and DNA damage, contributing to insights into metabolic pathways and potential therapeutic approaches for targeting cancer metabolism.
| CAS Number | 329-89-5 |
| Synonyms | 6-amino-3-pyridinecarboxamide |
| Molecular Formula | C6H7N3O |
| Purity | ≥95% |
| Target | Dehydrogenase |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 6-aminopyridine-3-carboxamide |
| InChI | InChI=1S/C6H7N3O/c7-5-2-1-4(3-9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10) |
| InChIKey | ZLWYEPMDOUQDBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
