For research use only. Not for therapeutic Use.
6-Aminoundecane(Cat No.:L007109), is a chemical compound with the molecular formula C11H25N. It is an organic compound belonging to the amine class, featuring a linear carbon chain containing eleven carbon atoms, with an amino group (-NH2) at the 6th carbon position. This compound serves as a valuable chemical intermediate and is employed in various chemical synthesis processes, particularly in the production of surfactants and polymers. Its properties make it useful in the formulation of specialized products in industries such as cosmetics, agriculture, and materials science, contributing to diverse applications within the chemical sector.
CAS Number | 33788-00-0 |
Molecular Formula | C11H25N |
Purity | ≥95% |
IUPAC Name | undecan-6-amine |
InChI | InChI=1S/C11H25N/c1-3-5-7-9-11(12)10-8-6-4-2/h11H,3-10,12H2,1-2H3 |
InChIKey | GFBRYGJZWXLRFR-UHFFFAOYSA-N |
SMILES | CCCCCC(CCCCC)N |