For research use only. Not for therapeutic Use.
6-Aza-2-thiothymine(Cat No.:L006733), is a heterocyclic organic compound derived from thymine.This compound contains a thiazole ring and is structurally related to thymine, a nucleobase found in DNA. 6-Aza-2-thiothymine has applications in medicinal chemistry and pharmaceutical research, where it is used as a building block for the synthesis of various biologically active compounds. Its unique structure gives it potential as an anti-cancer and anti-viral agent. Researchers explore its properties in drug development due to its ability to interact with biological molecules, making it valuable in the pursuit of novel therapies.
CAS Number | 615-76-9 |
Molecular Formula | C4H5N3OS |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
InChI | InChI=1S/C4H5N3OS/c1-2-3(8)5-4(9)7-6-2/h1H3,(H2,5,7,8,9) |
InChIKey | NKOPQOSBROLOFP-UHFFFAOYSA-N |
SMILES | CC1=NNC(=S)NC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |