For research use only. Not for therapeutic Use.
(-)-6-Azauridine 2’,3’,5’-triacetate(Cat No.:I001000)is a synthetic nucleoside analog used in antiviral and anticancer research. This compound, characterized by acetylated hydroxyl groups on the ribose moiety, enhances cellular uptake and stability. It acts by incorporating into RNA, disrupting nucleic acid synthesis and inhibiting viral replication or tumor cell proliferation. Its high purity and efficacy make it a valuable tool in preclinical studies, aiding in the development of new therapeutic agents. (-)-6-Azauridine 2’,3’,5’-triacetate contributes significantly to advancements in antiviral therapies and cancer treatment research.
Catalog Number | I001000 |
CAS Number | 2169-64-4 |
Synonyms | 2/’,3/’,5/’-Tri-O-acetyl-6-azauridine; Azaribine; 6-AzUrd-TA |
Molecular Formula | C14H17N3O9 |
Purity | ≥95% |
Target | Virus Protease |
Storage | -20°C |
IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
InChI | InChI=1S/C14H17N3O9/c1-6(18)23-5-9-11(24-7(2)19)12(25-8(3)20)13(26-9)17-14(22)16-10(21)4-15-17/h4,9,11-13H,5H2,1-3H3,(H,16,21,22)/t9-,11-,12-,13-/m1/s1 |
InChIKey | QQOBRRFOVWGIMD-OJAKKHQRSA-N |
SMILES | CC(=O)OCC1C(C(C(O1)N2C(=O)NC(=O)C=N2)OC(=O)C)OC(=O)C |