For research use only. Not for therapeutic Use.
6-Azauridine（Cat No.:I012078） is a synthetic triazine analog of uridine with antimetabolite activity. 6-Azauridine inhibits de novo pyrimidine synthesis and DNA synthesis and is converted intracellularly into mono, di, and triphosphate derivatives, which incorporate into RNA and inhibit protein synthesis.
| Catalog Number | I012078 |
| CAS Number | 54-25-1 |
| Synonyms | 2-β-D-Ribofuranosyl-1,2,4-triazine-3,5(2H,4H)-dione, 6-Azauracil riboside |
| Molecular Formula | C8H11N3O6 |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analog |
| Solubility | H₂O |
| Storage | 2-8°C |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| InChI | InChI=1S/C8H11N3O6/c12-2-3-5(14)6(15)7(17-3)11-8(16)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,16)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | WYXSYVWAUAUWLD-SHUUEZRQSA-N |
| SMILES | C1=NN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
