For research use only. Not for therapeutic Use.
6-Boc-3,6-diazabicyclo[3.1.1]heptane is a bicyclic compound used in organic synthesis and pharmaceutical research. The Boc (tert-butoxycarbonyl) group protects one of the nitrogen atoms in the structure, making it a valuable intermediate for creating complex molecules. Its rigid, bicyclic framework provides a unique scaffold for drug design, particularly in the development of enzyme inhibitors and receptor modulators. This compound is often used in medicinal chemistry to synthesize bioactive molecules, contributing to advancements in drug discovery and development.
CAS Number | 869494-16-6 |
Molecular Formula | C10H18N2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-7-4-8(12)6-11-5-7/h7-8,11H,4-6H2,1-3H3 |
InChIKey | OUFBVDKNEWUFHP-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1C2CC1CNC2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |