For research use only. Not for therapeutic Use.
6-Bromo-1-chloronaphthalene(CAT: L000212) is an essential compound in organic chemistry, particularly in the synthesis of various organic molecules. This compound serves as a valuable building block for creating a wide range of organic intermediates, including pharmaceutical agents and agrochemicals. Its halogen substitution pattern provides unique reactivity, allowing for precise structural modifications.
CAS Number | 1000391-24-1 |
Molecular Formula | C10H6BrCl |
Purity | ≥95% |
IUPAC Name | 6-bromo-1-chloronaphthalene |
InChI | InChI=1S/C10H6BrCl/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6H |
InChIKey | KUQJGFGVAJMCNG-UHFFFAOYSA-N |