For research use only. Not for therapeutic Use.
6-Bromo-1,2,3,4-tetrahydro-1,5-naphthyridine is a bicyclic compound characterized by a bromine substitution at the 6-position of a tetrahydronaphthyridine structure. This compound is significant in medicinal chemistry, known for its potential biological activities, including antimicrobial and anticancer properties. The bromine atom enhances its reactivity, enabling various chemical modifications. Its unique structure allows for diverse functionalizations, making it valuable in the synthesis of novel therapeutic agents and in exploring new applications in organic synthesis and drug discovery.
Catalog Number | L020265 |
CAS Number | 1219022-46-4 |
Molecular Formula | C8H9BrN2 |
Purity | ≥95% |
IUPAC Name | 6-bromo-1,2,3,4-tetrahydro-1,5-naphthyridine |
InChI | InChI=1S/C8H9BrN2/c9-8-4-3-6-7(11-8)2-1-5-10-6/h3-4,10H,1-2,5H2 |
InChIKey | IDYOBWKVTSMJBF-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=N2)Br)NC1 |