For research use only. Not for therapeutic Use.
6-Bromo-2(1H)-quinolinone is a halogenated quinolinone derivative, featuring a bromine atom at the 6th position and a lactam (2(1H)-quinolinone) core. This compound is of interest in medicinal chemistry due to the bioactivity of quinolinone derivatives, which are often explored for their potential anticancer, antimicrobial, and anti-inflammatory properties. The bromine substituent allows for further functionalization through cross-coupling reactions, making it a useful intermediate in organic synthesis and drug discovery, where it’s applied in the development of novel therapeutic agents.
CAS Number | 1810-66-8 |
Synonyms | 6-Bromo-2(1H)-quinolone; 6-Bromo-2-hydroxyquinoline;?6-Bromo-2-quinolinol; 6-Bromocarbostyril; |
Molecular Formula | C9H6BrNO |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | 6-bromo-1H-quinolin-2-one |
InChI | InChI=1S/C9H6BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5H,(H,11,12) |
InChIKey | YLAFBGATSQRSTB-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=O)N2)C=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |