For research use only. Not for therapeutic Use.
6-Bromo-2-chloro-3-methylpyridine (Cat.No:L004083) is a significant chemical compound with versatile applications. Its unique structure, incorporating bromine, chlorine, and a methyl group, imparts distinctive reactivity and properties. This compound is utilized as a valuable building block in the synthesis of specialized molecules with applications in pharmaceutical and chemical research.
Catalog Number | L004083 |
CAS Number | 1211539-10-4 |
Molecular Formula | C6H5BrClN |
Purity | ≥95% |
IUPAC Name | 6-bromo-2-chloro-3-methylpyridine |
InChI | InChI=1S/C6H5BrClN/c1-4-2-3-5(7)9-6(4)8/h2-3H,1H3 |
InChIKey | LVEZNJUOFFMXKU-UHFFFAOYSA-N |
SMILES | CC1=C(N=C(C=C1)Br)Cl |