For research use only. Not for therapeutic Use.
(6-Bromo-2-fluoro-3-(trifluoromethyl)phenyl)methanol(Cat No.:L012795)is an organic compound used in pharmaceutical research and organic synthesis. It features a substituted phenyl ring with a bromine atom at the 6-position, a fluorine atom at the 2-position, and a trifluoromethyl group at the 3-position, along with a hydroxymethyl group. This structure offers unique reactivity and stability, making it a valuable intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its functional groups allow for diverse chemical transformations, essential for researchers focused on drug discovery and advanced material science.
CAS Number | 1352718-85-4 |
Molecular Formula | C8H5BrF4O |
Purity | ≥95% |
IUPAC Name | [6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]methanol |
InChI | InChI=1S/C8H5BrF4O/c9-6-2-1-5(8(11,12)13)7(10)4(6)3-14/h1-2,14H,3H2 |
InChIKey | NTLXXEBGORTQOW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)CO)Br |